C7H13N3O3 — CID 130625812
1-(2-hydroxyethyl)-3-(5-oxopyrrolidin-3-yl)urea (PubChem CID 130625812) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(5-oxopyrrolidin-3-yl)urea.
| Compound Name | 1-(2-hydroxyethyl)-3-(5-oxopyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 130625812 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(5-oxopyrrolidin-3-yl)urea |
| SMILES | O=C1CC(NC(=O)NCCO)CN1 |
| InChI | InChI=1S/C7H13N3O3/c11-2-1-8-7(13)10-5-3-6(12)9-4-5/h5,11H,1-4H2,(H,9,12)(H2,8,10,13) |
| InChIKey | DWSNRTZJYUXGHY-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |