C13H17N3O2 — CID 95985030
1-[(3R)-5-oxopyrrolidin-3-yl]-3-(2-phenylethyl)urea (PubChem CID 95985030) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-[(3R)-5-oxopyrrolidin-3-yl]-3-(2-phenylethyl)urea.
| Compound Name | 1-[(3R)-5-oxopyrrolidin-3-yl]-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 95985030 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-[(3R)-5-oxopyrrolidin-3-yl]-3-(2-phenylethyl)urea |
| SMILES | O=C1C[C@@H](NC(=O)NCCc2ccccc2)CN1 |
| InChI | InChI=1S/C13H17N3O2/c17-12-8-11(9-15-12)16-13(18)14-7-6-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,15,17)(H2,14,16,18)/t11-/m1/s1 |
| InChIKey | GLVRSIUPBBMLOU-LLVKDONJSA-N |
| XLogP | 0.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |