C6H11N3OS — CID 106186247
1-methyl-3-(5-oxopyrrolidin-3-yl)thiourea (PubChem CID 106186247) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is 1-methyl-3-(5-oxopyrrolidin-3-yl)thiourea.
| Compound Name | 1-methyl-3-(5-oxopyrrolidin-3-yl)thiourea |
|---|---|
| PubChem CID | 106186247 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 1-methyl-3-(5-oxopyrrolidin-3-yl)thiourea |
| SMILES | CNC(=S)NC1CNC(=O)C1 |
| InChI | InChI=1S/C6H11N3OS/c1-7-6(11)9-4-2-5(10)8-3-4/h4H,2-3H2,1H3,(H,8,10)(H2,7,9,11) |
| InChIKey | LXGDFYKAOLVLBH-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|