C10H17N3O2S — CID 106189156
2-carbamothioyl-N-(5-oxopyrrolidin-3-yl)pentanamide (PubChem CID 106189156) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-carbamothioyl-N-(5-oxopyrrolidin-3-yl)pentanamide.
| Compound Name | 2-carbamothioyl-N-(5-oxopyrrolidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 106189156 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-carbamothioyl-N-(5-oxopyrrolidin-3-yl)pentanamide |
| SMILES | CCCC(C(=O)NC1CNC(=O)C1)C(N)=S |
| InChI | InChI=1S/C10H17N3O2S/c1-2-3-7(9(11)16)10(15)13-6-4-8(14)12-5-6/h6-7H,2-5H2,1H3,(H2,11,16)(H,12,14)(H,13,15) |
| InChIKey | JGTCATMALROYDK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|