C15H20N2O3S — CID 9095280
methyl 4-[[(4S)-3,4-dihydro-2H-chromen-4-yl]carbamothioylamino]butanoate (PubChem CID 9095280) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is methyl 4-[[(4S)-3,4-dihydro-2H-chromen-4-yl]carbamothioylamino]butanoate.
| Compound Name | methyl 4-[[(4S)-3,4-dihydro-2H-chromen-4-yl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 9095280 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | methyl 4-[[(4S)-3,4-dihydro-2H-chromen-4-yl]carbamothioylamino]butanoate |
| SMILES | COC(=O)CCCNC(=S)N[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C15H20N2O3S/c1-19-14(18)7-4-9-16-15(21)17-12-8-10-20-13-6-3-2-5-11(12)13/h2-3,5-6,12H,4,7-10H2,1H3,(H2,16,17,21)/t12-/m0/s1 |
| InChIKey | BCFYGOZCQWURFX-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|