C23H29BrN2O2S — CID 145278013
ethyl 7-[(3-bromo-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate (PubChem CID 145278013) has the molecular formula C23H29BrN2O2S and a molecular weight of 477.47 g/mol. Its IUPAC name is ethyl 7-[(3-bromo-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate.
| Compound Name | ethyl 7-[(3-bromo-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate |
|---|---|
| PubChem CID | 145278013 |
| Molecular Formula | C23H29BrN2O2S |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | ethyl 7-[(3-bromo-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC1c2ccc(Br)cc2SN(C)c2ccccc21 |
| InChI | InChI=1S/C23H29BrN2O2S/c1-3-28-22(27)12-6-4-5-9-15-25-23-18-10-7-8-11-20(18)26(2)29-21-16-17(24)13-14-19(21)23/h7-8,10-11,13-14,16,23,25H,3-6,9,12,15H2,1-2H3 |
| InChIKey | MZKCGNJNWAYZMW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|