C29H34N2O4S — CID 130287089
ethyl 7-[(6-methyl-5,5-dioxo-3-phenyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate (PubChem CID 130287089) has the molecular formula C29H34N2O4S and a molecular weight of 506.67 g/mol. Its IUPAC name is ethyl 7-[(6-methyl-5,5-dioxo-3-phenyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate.
| Compound Name | ethyl 7-[(6-methyl-5,5-dioxo-3-phenyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate |
|---|---|
| PubChem CID | 130287089 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | ethyl 7-[(6-methyl-5,5-dioxo-3-phenyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C29H34N2O4S/c1-3-35-28(32)17-9-4-5-12-20-30-29-24-15-10-11-16-26(24)31(2)36(33,34)27-21-23(18-19-25(27)29)22-13-7-6-8-14-22/h6-8,10-11,13-16,18-19,21,29-30H,3-5,9,12,17,20H2,1-2H3 |
| InChIKey | IJLAYEBQKQILER-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|