C23H31IN2O2S — CID 153457838
3-iodo-6-methyl-N-nonyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 153457838) has the molecular formula C23H31IN2O2S and a molecular weight of 526.48 g/mol. Its IUPAC name is 3-iodo-6-methyl-N-nonyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | 3-iodo-6-methyl-N-nonyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 153457838 |
| Molecular Formula | C23H31IN2O2S |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 3-iodo-6-methyl-N-nonyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | CCCCCCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(I)ccc21 |
| InChI | InChI=1S/C23H31IN2O2S/c1-3-4-5-6-7-8-11-16-25-23-19-12-9-10-13-21(19)26(2)29(27,28)22-17-18(24)14-15-20(22)23/h9-10,12-15,17,23,25H,3-8,11,16H2,1-2H3 |
| InChIKey | IWOYABNULIEKGP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|