C22H29FN2O2S — CID 130287075
3-fluoro-6-methyl-N-octyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 130287075) has the molecular formula C22H29FN2O2S and a molecular weight of 404.55 g/mol. Its IUPAC name is 3-fluoro-6-methyl-N-octyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | 3-fluoro-6-methyl-N-octyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 130287075 |
| Molecular Formula | C22H29FN2O2S |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 3-fluoro-6-methyl-N-octyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | CCCCCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C22H29FN2O2S/c1-3-4-5-6-7-10-15-24-22-18-11-8-9-12-20(18)25(2)28(26,27)21-16-17(23)13-14-19(21)22/h8-9,11-14,16,22,24H,3-7,10,15H2,1-2H3 |
| InChIKey | UQMRLISJHPCVFI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|