C18H20ClN2O3S- — CID 163425855
4-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]butan-1-olate (PubChem CID 163425855) has the molecular formula C18H20ClN2O3S- and a molecular weight of 379.89 g/mol. Its IUPAC name is 4-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]butan-1-olate.
| Compound Name | 4-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]butan-1-olate |
|---|---|
| PubChem CID | 163425855 |
| Molecular Formula | C18H20ClN2O3S- |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 4-[(3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]butan-1-olate |
| SMILES | CN1c2ccccc2C(NCCCC[O-])c2ccc(Cl)cc2S1(=O)=O |
| InChI | InChI=1S/C18H20ClN2O3S/c1-21-16-7-3-2-6-14(16)18(20-10-4-5-11-22)15-9-8-13(19)12-17(15)25(21,23)24/h2-3,6-9,12,18,20H,4-5,10-11H2,1H3/q-1 |
| InChIKey | AMLWMGOGQODELI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|