C19H21ClN2O4S — CID 169445656
5-[[(11R)-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl]amino]-2,2,3,3,4,4,5,5-octadeuteriopentanoic acid (PubChem CID 169445656) has the molecular formula C19H21ClN2O4S and a molecular weight of 416.96 g/mol. Its IUPAC name is 5-[[(11R)-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl]amino]-2,2,3,3,4,4,5,5-octadeuteriopentanoic acid.
| Compound Name | 5-[[(11R)-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl]amino]-2,2,3,3,4,4,5,5-octadeuteriopentanoic acid |
|---|---|
| PubChem CID | 169445656 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 416.96 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5-[[(11R)-3-chloro-6-methyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-yl]amino]-2,2,3,3,4,4,5,5-octadeuteriopentanoic acid |
| SMILES | [2H]C([2H])(N[C@@H]1c2ccccc2N(C)S(=O)(=O)c2cc(Cl)ccc21)C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |
| InChI | InChI=1S/C19H21ClN2O4S/c1-22-16-7-3-2-6-14(16)19(21-11-5-4-8-18(23)24)15-10-9-13(20)12-17(15)27(22,25)26/h2-3,6-7,9-10,12,19,21H,4-5,8,11H2,1H3,(H,23,24)/t19-/m1/s1/i4D2,5D2,8D2,11D2 |
| InChIKey | BYPYVXCZPZLHBO-HRIOJTHRSA-N |
| XLogP | 3.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.96 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |