About N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine
N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine (PubChem CID 159744266) has the molecular formula C18H22N2O2S
and a molecular weight of 330.45 g/mol. Its IUPAC name is N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine.
Molecular Properties
| Compound Name | N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine |
| PubChem CID | 159744266 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine |
| SMILES | CCCCNC1c2ccccc2N(C)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C18H22N2O2S/c1-3-4-13-19-18-14-9-5-7-11-16(14)20(2)23(21,22)17-12-8-6-10-15(17)18/h5-12,18-19H,3-4,13H2,1-2H3 |
| InChIKey | NCVOOAUGHMKECI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine?
The IUPAC name of N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine (CID 159744266) is N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine.
What is the SMILES notation for N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine?
The canonical SMILES for N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine is CCCCNC1c2ccccc2N(C)S(=O)(=O)c2ccccc21.
What is the InChIKey of N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine?
The InChIKey is NCVOOAUGHMKECI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2S/c1-3-4-13-19-18-14-9-5-7-11-16(14)20(2)23(21,22)17-12-8-6-10-15(17)18/h5-12,18-19H,3-4,13H2,1-2H3.
What are the key properties of N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine?
N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine has a molecular weight of 330.45 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-6-methyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-amine is sourced from PubChem (CID 159744266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).