C23H30N2O5S — CID 158253637
carbon dioxide;6-methyl-11-(octylamino)-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-3-ol (PubChem CID 158253637) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is carbon dioxide;6-methyl-11-(octylamino)-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-3-ol.
| Compound Name | carbon dioxide;6-methyl-11-(octylamino)-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-3-ol |
|---|---|
| PubChem CID | 158253637 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | carbon dioxide;6-methyl-11-(octylamino)-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-3-ol |
| SMILES | CCCCCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(O)ccc21.O=C=O |
| InChI | InChI=1S/C22H30N2O3S.CO2/c1-3-4-5-6-7-10-15-23-22-18-11-8-9-12-20(18)24(2)28(26,27)21-16-17(25)13-14-19(21)22;2-1-3/h8-9,11-14,16,22-23,25H,3-7,10,15H2,1-2H3; |
| InChIKey | GHAACBCJVGBQLJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|