C19H21F3N2O2S — CID 130287115
3,6-dimethyl-5,5-dioxo-N-(4,4,4-trifluorobutyl)-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 130287115) has the molecular formula C19H21F3N2O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 3,6-dimethyl-5,5-dioxo-N-(4,4,4-trifluorobutyl)-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | 3,6-dimethyl-5,5-dioxo-N-(4,4,4-trifluorobutyl)-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 130287115 |
| Molecular Formula | C19H21F3N2O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 3,6-dimethyl-5,5-dioxo-N-(4,4,4-trifluorobutyl)-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)N(C)c1ccccc1C2NCCCC(F)(F)F |
| InChI | InChI=1S/C19H21F3N2O2S/c1-13-8-9-15-17(12-13)27(25,26)24(2)16-7-4-3-6-14(16)18(15)23-11-5-10-19(20,21)22/h3-4,6-9,12,18,23H,5,10-11H2,1-2H3 |
| InChIKey | HQXYPNZLGGCVLL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|