C24H23F3N2O2S — CID 71263402
N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 71263402) has the molecular formula C24H23F3N2O2S and a molecular weight of 460.52 g/mol. Its IUPAC name is N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71263402 |
| Molecular Formula | C24H23F3N2O2S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-[3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)propyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN1c2ccccc2CCc2ccccc21)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H23F3N2O2S/c25-24(26,27)20-12-14-21(15-13-20)32(30,31)28-16-5-17-29-22-8-3-1-6-18(22)10-11-19-7-2-4-9-23(19)29/h1-4,6-9,12-15,28H,5,10-11,16-17H2 |
| InChIKey | XAWGOZHVPJJZKH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|