C24H32N2O4S2 — CID 157364178
carbon dioxide;6-methyl-3-methylsulfanyl-N-octyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 157364178) has the molecular formula C24H32N2O4S2 and a molecular weight of 476.66 g/mol. Its IUPAC name is carbon dioxide;6-methyl-3-methylsulfanyl-N-octyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | carbon dioxide;6-methyl-3-methylsulfanyl-N-octyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 157364178 |
| Molecular Formula | C24H32N2O4S2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | carbon dioxide;6-methyl-3-methylsulfanyl-N-octyl-5,5-dioxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | CCCCCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(SC)ccc21.O=C=O |
| InChI | InChI=1S/C23H32N2O2S2.CO2/c1-4-5-6-7-8-11-16-24-23-19-12-9-10-13-21(19)25(2)29(26,27)22-17-18(28-3)14-15-20(22)23;2-1-3/h9-10,12-15,17,23-24H,4-8,11,16H2,1-3H3; |
| InChIKey | BIZIVKQZMMCAGO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|