C21H27ClN2O2S — CID 159309207
3-chloro-N-(5-methoxypentyl)-6-methyl-5-methylidene-5-oxo-11H-benzo[c][2,1]benzothiazepin-11-amine (PubChem CID 159309207) has the molecular formula C21H27ClN2O2S and a molecular weight of 406.98 g/mol. Its IUPAC name is 3-chloro-N-(5-methoxypentyl)-6-methyl-5-methylidene-5-oxo-11H-benzo[c][2,1]benzothiazepin-11-amine.
| Compound Name | 3-chloro-N-(5-methoxypentyl)-6-methyl-5-methylidene-5-oxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
|---|---|
| PubChem CID | 159309207 |
| Molecular Formula | C21H27ClN2O2S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-chloro-N-(5-methoxypentyl)-6-methyl-5-methylidene-5-oxo-11H-benzo[c][2,1]benzothiazepin-11-amine |
| SMILES | C=S1(=O)c2cc(Cl)ccc2C(NCCCCCOC)c2ccccc2N1C |
| InChI | InChI=1S/C21H27ClN2O2S/c1-24-19-10-6-5-9-17(19)21(23-13-7-4-8-14-26-2)18-12-11-16(22)15-20(18)27(24,3)25/h5-6,9-12,15,21,23H,3-4,7-8,13-14H2,1-2H3 |
| InChIKey | LCHXAHDNMLFRTR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|