C23H31FN2O4S — CID 141473011
ethyl 7-[(3-fluoro-5,5-dihydroxy-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate (PubChem CID 141473011) has the molecular formula C23H31FN2O4S and a molecular weight of 450.58 g/mol. Its IUPAC name is ethyl 7-[(3-fluoro-5,5-dihydroxy-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate.
| Compound Name | ethyl 7-[(3-fluoro-5,5-dihydroxy-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate |
|---|---|
| PubChem CID | 141473011 |
| Molecular Formula | C23H31FN2O4S |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | ethyl 7-[(3-fluoro-5,5-dihydroxy-6-methyl-11H-benzo[c][2,1]benzothiazepin-11-yl)amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC1c2ccccc2N(C)S(O)(O)c2cc(F)ccc21 |
| InChI | InChI=1S/C23H31FN2O4S/c1-3-30-22(27)12-6-4-5-9-15-25-23-18-10-7-8-11-20(18)26(2)31(28,29)21-16-17(24)13-14-19(21)23/h7-8,10-11,13-14,16,23,25,28-29H,3-6,9,12,15H2,1-2H3 |
| InChIKey | PKTOIEPJWZWSPZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|