C24H31FN2O4S — CID 147900927
ethyl 7-[(2-fluoro-3,6-dimethyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]heptanoate (PubChem CID 147900927) has the molecular formula C24H31FN2O4S and a molecular weight of 462.59 g/mol. Its IUPAC name is ethyl 7-[(2-fluoro-3,6-dimethyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]heptanoate.
| Compound Name | ethyl 7-[(2-fluoro-3,6-dimethyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]heptanoate |
|---|---|
| PubChem CID | 147900927 |
| Molecular Formula | C24H31FN2O4S |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | ethyl 7-[(2-fluoro-3,6-dimethyl-5,5-dioxo-11H-benzo[c][1,2]benzothiazepin-11-yl)amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC1c2ccccc2N(C)S(=O)(=O)c2cc(C)c(F)cc21 |
| InChI | InChI=1S/C24H31FN2O4S/c1-4-31-23(28)13-7-5-6-10-14-26-24-18-11-8-9-12-21(18)27(3)32(29,30)22-15-17(2)20(25)16-19(22)24/h8-9,11-12,15-16,24,26H,4-7,10,13-14H2,1-3H3 |
| InChIKey | IEGBQZHVYZSOCQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|