C18H17ClN2O3S — CID 11164782
1-(2-chloro-10-methyl-9,9-dioxo-9lambda6-thia-10,14-diazatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,12,17-hexaen-14-yl)ethanone (PubChem CID 11164782) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is 1-(2-chloro-10-methyl-9,9-dioxo-9lambda6-thia-10,14-diazatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,12,17-hexaen-14-yl)ethanone.
| Compound Name | 1-(2-chloro-10-methyl-9,9-dioxo-9lambda6-thia-10,14-diazatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,12,17-hexaen-14-yl)ethanone |
|---|---|
| PubChem CID | 11164782 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-(2-chloro-10-methyl-9,9-dioxo-9lambda6-thia-10,14-diazatetracyclo[9.7.0.03,8.013,17]octadeca-1(11),3,5,7,12,17-hexaen-14-yl)ethanone |
| SMILES | CC(=O)N1CCc2cc3c(cc21)N(C)S(=O)(=O)c1ccccc1C3Cl |
| InChI | InChI=1S/C18H17ClN2O3S/c1-11(22)21-8-7-12-9-14-16(10-15(12)21)20(2)25(23,24)17-6-4-3-5-13(17)18(14)19/h3-6,9-10,18H,7-8H2,1-2H3 |
| InChIKey | UKLIPOGCEOSAKL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|