C10H8ClNO2 — CID 54181433
1-(2-chlorophenyl)pyrrole-2,5-diol (PubChem CID 54181433) has the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. Its IUPAC name is 1-(2-chlorophenyl)pyrrole-2,5-diol.
| Compound Name | 1-(2-chlorophenyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54181433 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 1-(2-chlorophenyl)pyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1-c1ccccc1Cl |
| InChI | InChI=1S/C10H8ClNO2/c11-7-3-1-2-4-8(7)12-9(13)5-6-10(12)14/h1-6,13-14H |
| InChIKey | PCBXSEXFJONUNF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |