C19H17NO8S — CID 57051435
methyl 2-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxylate (PubChem CID 57051435) has the molecular formula C19H17NO8S and a molecular weight of 419.41 g/mol. Its IUPAC name is methyl 2-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxylate.
| Compound Name | methyl 2-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxylate |
|---|---|
| PubChem CID | 57051435 |
| Molecular Formula | C19H17NO8S |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | methyl 2-[(7-methoxy-1,3-benzodioxol-5-yl)methyl]-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)c2ccccc2S(=O)(=O)N1Cc1cc(OC)c2c(c1)OCO2 |
| InChI | InChI=1S/C19H17NO8S/c1-25-13-7-11(8-14-18(13)28-10-27-14)9-20-16(19(22)26-2)17(21)12-5-3-4-6-15(12)29(20,23)24/h3-8,16H,9-10H2,1-2H3 |
| InChIKey | ASPSWPXKCBWFGE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|