C33H34N2O8 — CID 166633795
(E)-1-[(2S,5S)-4-acetyl-2,5-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 166633795) has the molecular formula C33H34N2O8 and a molecular weight of 586.64 g/mol. Its IUPAC name is (E)-1-[(2S,5S)-4-acetyl-2,5-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(2S,5S)-4-acetyl-2,5-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 166633795 |
| Molecular Formula | C33H34N2O8 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | (E)-1-[(2S,5S)-4-acetyl-2,5-bis[(7-methoxy-1,3-benzodioxol-5-yl)methyl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | COc1cc(C[C@H]2CN(C(=O)/C=C/c3ccccc3)[C@@H](Cc3cc(OC)c4c(c3)OCO4)CN2C(C)=O)cc2c1OCO2 |
| InChI | InChI=1S/C33H34N2O8/c1-21(36)34-17-26(12-24-14-28(39-3)33-30(16-24)41-20-43-33)35(31(37)10-9-22-7-5-4-6-8-22)18-25(34)11-23-13-27(38-2)32-29(15-23)40-19-42-32/h4-10,13-16,25-26H,11-12,17-20H2,1-3H3/b10-9+/t25-,26-/m0/s1 |
| InChIKey | NDRSITHOPMKCCO-MKRYHERSSA-N |
| XLogP | 4.09 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|