C17H16N2O4S — CID 141053314
2-methyl-1,1-dioxo-4-phenylmethoxy-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 141053314) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-methyl-1,1-dioxo-4-phenylmethoxy-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 2-methyl-1,1-dioxo-4-phenylmethoxy-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 141053314 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-methyl-1,1-dioxo-4-phenylmethoxy-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CN1C(C(N)=O)=C(OCc2ccccc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H16N2O4S/c1-19-15(17(18)20)16(23-11-12-7-3-2-4-8-12)13-9-5-6-10-14(13)24(19,21)22/h2-10H,11H2,1H3,(H2,18,20) |
| InChIKey | YMPQNDTVNNZZFQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |