C24H20N2O5S — CID 23605516
N-(3-benzoyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-4-yl)-2-phenoxyacetamide (PubChem CID 23605516) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is N-(3-benzoyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-4-yl)-2-phenoxyacetamide.
| Compound Name | N-(3-benzoyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-4-yl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 23605516 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-(3-benzoyl-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-4-yl)-2-phenoxyacetamide |
| SMILES | CN1C(C(=O)c2ccccc2)=C(NC(=O)COc2ccccc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C24H20N2O5S/c1-26-23(24(28)17-10-4-2-5-11-17)22(19-14-8-9-15-20(19)32(26,29)30)25-21(27)16-31-18-12-6-3-7-13-18/h2-15H,16H2,1H3,(H,25,27) |
| InChIKey | JSMXBAPNVVSGRE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |