C32H30N2O5S — CID 44666434
N-(3-benzoyl-1,1-dioxo-2-pentyl-1λ6,2-benzothiazin-4-yl)-2-naphthalen-2-yloxyacetamide (PubChem CID 44666434) has the molecular formula C32H30N2O5S and a molecular weight of 554.67 g/mol. Its IUPAC name is N-(3-benzoyl-1,1-dioxo-2-pentyl-1λ6,2-benzothiazin-4-yl)-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-(3-benzoyl-1,1-dioxo-2-pentyl-1λ6,2-benzothiazin-4-yl)-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 44666434 |
| Molecular Formula | C32H30N2O5S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | N-(3-benzoyl-1,1-dioxo-2-pentyl-1λ6,2-benzothiazin-4-yl)-2-naphthalen-2-yloxyacetamide |
| SMILES | CCCCCN1C(C(=O)c2ccccc2)=C(NC(=O)COc2ccc3ccccc3c2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C32H30N2O5S/c1-2-3-11-20-34-31(32(36)24-13-5-4-6-14-24)30(27-16-9-10-17-28(27)40(34,37)38)33-29(35)22-39-26-19-18-23-12-7-8-15-25(23)21-26/h4-10,12-19,21H,2-3,11,20,22H2,1H3,(H,33,35) |
| InChIKey | RGKOZLHWHUQKFL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|