C18H13NO4S2 — CID 90960605
3-(1-benzothiophene-2-carbonyl)-2-methyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one (PubChem CID 90960605) has the molecular formula C18H13NO4S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(1-benzothiophene-2-carbonyl)-2-methyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one.
| Compound Name | 3-(1-benzothiophene-2-carbonyl)-2-methyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 90960605 |
| Molecular Formula | C18H13NO4S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 3-(1-benzothiophene-2-carbonyl)-2-methyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
| SMILES | CN1C(C(=O)c2cc3ccccc3s2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H13NO4S2/c1-19-16(17(20)12-7-3-5-9-15(12)25(19,22)23)18(21)14-10-11-6-2-4-8-13(11)24-14/h2-10,16H,1H3 |
| InChIKey | YMHJGEJMPASUOK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|