C15H12ClN3O4S — CID 54720115
N-(6-chloro-2-pyridinyl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54720115) has the molecular formula C15H12ClN3O4S and a molecular weight of 365.80 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54720115 |
| Molecular Formula | C15H12ClN3O4S |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-4-hydroxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CN1C(C(=O)Nc2cccc(Cl)n2)=C(O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C15H12ClN3O4S/c1-19-13(15(21)18-12-8-4-7-11(16)17-12)14(20)9-5-2-3-6-10(9)24(19,22)23/h2-8,20H,1H3,(H,17,18,21) |
| InChIKey | PFDBGXHVSBXDHS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|