C16H16N3O4S+ — CID 54715406
4-hydroxy-2-methyl-N-(1-methylpyridin-1-ium-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54715406) has the molecular formula C16H16N3O4S+ and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-hydroxy-2-methyl-N-(1-methylpyridin-1-ium-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 4-hydroxy-2-methyl-N-(1-methylpyridin-1-ium-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54715406 |
| Molecular Formula | C16H16N3O4S+ |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-hydroxy-2-methyl-N-(1-methylpyridin-1-ium-2-yl)-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CN1C(C(=O)Nc2cccc[n+]2C)=C(O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C16H15N3O4S/c1-18-10-6-5-9-13(18)17-16(21)14-15(20)11-7-3-4-8-12(11)24(22,23)19(14)2/h3-10H,1-2H3,(H,20,21)/p+1 |
| InChIKey | ZGAOGEWXGOUSKB-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|