C21H21N3O6S — CID 90772934
N-(2-methoxyethyl)-6-[3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]pyridine-2-carboxamide (PubChem CID 90772934) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-[3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]pyridine-2-carboxamide.
| Compound Name | N-(2-methoxyethyl)-6-[3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90772934 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | N-(2-methoxyethyl)-6-[3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazin-3-yl)-3-oxoprop-1-enyl]pyridine-2-carboxamide |
| SMILES | COCCNC(=O)c1cccc(C=CC(=O)C2C(=O)c3ccccc3S(=O)(=O)N2C)n1 |
| InChI | InChI=1S/C21H21N3O6S/c1-24-19(20(26)15-7-3-4-9-18(15)31(24,28)29)17(25)11-10-14-6-5-8-16(23-14)21(27)22-12-13-30-2/h3-11,19H,12-13H2,1-2H3,(H,22,27) |
| InChIKey | CXYXMBMHFMPXGC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|