C10H10O3S — CID 822395
(2R)-2-ethyl-1,1-dioxo-1-benzothiophen-3-one (PubChem CID 822395) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is (2R)-2-ethyl-1,1-dioxo-1-benzothiophen-3-one.
| Compound Name | (2R)-2-ethyl-1,1-dioxo-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 822395 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (2R)-2-ethyl-1,1-dioxo-1-benzothiophen-3-one |
| SMILES | CC[C@@H]1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C10H10O3S/c1-2-8-10(11)7-5-3-4-6-9(7)14(8,12)13/h3-6,8H,2H2,1H3/t8-/m1/s1 |
| InChIKey | QGORIRPNIXUMQP-MRVPVSSYSA-N |
| XLogP | 1.44 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |