About (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one
(6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one (PubChem CID 96733618) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one.
Analyze (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one?
The IUPAC name of (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one (CID 96733618) is (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one.
What is the SMILES notation for (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one?
The canonical SMILES for (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one is N[C@@H]1Cc2cccnc2C1=O.
What is the InChIKey of (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one?
The InChIKey is ZJLPVFCGRUAEIQ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H8N2O/c9-6-4-5-2-1-3-10-7(5)8(6)11/h1-3,6H,4,9H2/t6-/m1/s1.
What are the key properties of (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one?
(6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one has a molecular weight of 148.16 g/mol, XLogP of 0.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-amino-5,6-dihydrocyclopenta[b]pyridin-7-one is sourced from PubChem (CID 96733618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).