C15H13NO — CID 12036201
6-phenyl-6,7-dihydro-5H-quinolin-8-one (PubChem CID 12036201) has the molecular formula C15H13NO and a molecular weight of 223.28 g/mol. Its IUPAC name is 6-phenyl-6,7-dihydro-5H-quinolin-8-one.
| Compound Name | 6-phenyl-6,7-dihydro-5H-quinolin-8-one |
|---|---|
| PubChem CID | 12036201 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 6-phenyl-6,7-dihydro-5H-quinolin-8-one |
| SMILES | O=C1CC(c2ccccc2)Cc2cccnc21 |
| InChI | InChI=1S/C15H13NO/c17-14-10-13(11-5-2-1-3-6-11)9-12-7-4-8-16-15(12)14/h1-8,13H,9-10H2 |
| InChIKey | IJRZSLJQUOLLSZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |