C9H8N2OS — CID 23198093
2-amino-1-thieno[3,2-b]pyridin-3-ylethanone (PubChem CID 23198093) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-amino-1-thieno[3,2-b]pyridin-3-ylethanone.
| Compound Name | 2-amino-1-thieno[3,2-b]pyridin-3-ylethanone |
|---|---|
| PubChem CID | 23198093 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-amino-1-thieno[3,2-b]pyridin-3-ylethanone |
| SMILES | NCC(=O)c1csc2cccnc12 |
| InChI | InChI=1S/C9H8N2OS/c10-4-7(12)6-5-13-8-2-1-3-11-9(6)8/h1-3,5H,4,10H2 |
| InChIKey | IPDQKYVHAZJKAN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |