C9H9N3O — CID 82411246
2-amino-1-(1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone (PubChem CID 82411246) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is 2-amino-1-(1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone.
| Compound Name | 2-amino-1-(1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone |
|---|---|
| PubChem CID | 82411246 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 2-amino-1-(1H-pyrrolo[3,2-b]pyridin-3-yl)ethanone |
| SMILES | NCC(=O)c1c[nH]c2cccnc12 |
| InChI | InChI=1S/C9H9N3O/c10-4-8(13)6-5-12-7-2-1-3-11-9(6)7/h1-3,5,12H,4,10H2 |
| InChIKey | CVVRVUANUVJGLF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |