C9H5N2O3- — CID 22476269
2-oxo-2-(1H-pyrrolo[3,2-b]pyridin-3-yl)acetate (PubChem CID 22476269) has the molecular formula C9H5N2O3- and a molecular weight of 189.15 g/mol. Its IUPAC name is 2-oxo-2-(1H-pyrrolo[3,2-b]pyridin-3-yl)acetate.
| Compound Name | 2-oxo-2-(1H-pyrrolo[3,2-b]pyridin-3-yl)acetate |
|---|---|
| PubChem CID | 22476269 |
| Molecular Formula | C9H5N2O3- |
| Molecular Weight | 189.15 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | 2-oxo-2-(1H-pyrrolo[3,2-b]pyridin-3-yl)acetate |
| SMILES | O=C([O-])C(=O)c1c[nH]c2cccnc12 |
| InChI | InChI=1S/C9H6N2O3/c12-8(9(13)14)5-4-11-6-2-1-3-10-7(5)6/h1-4,11H,(H,13,14)/p-1 |
| InChIKey | KZECFOSVDBEZOG-UHFFFAOYSA-M |
| XLogP | -0.50 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|