C15H19N3O2 — CID 154652727
cyclohexylmethyl N-(1H-pyrrolo[3,2-b]pyridin-3-yl)carbamate (PubChem CID 154652727) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is cyclohexylmethyl N-(1H-pyrrolo[3,2-b]pyridin-3-yl)carbamate.
| Compound Name | cyclohexylmethyl N-(1H-pyrrolo[3,2-b]pyridin-3-yl)carbamate |
|---|---|
| PubChem CID | 154652727 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | cyclohexylmethyl N-(1H-pyrrolo[3,2-b]pyridin-3-yl)carbamate |
| SMILES | O=C(Nc1c[nH]c2cccnc12)OCC1CCCCC1 |
| InChI | InChI=1S/C15H19N3O2/c19-15(20-10-11-5-2-1-3-6-11)18-13-9-17-12-7-4-8-16-14(12)13/h4,7-9,11,17H,1-3,5-6,10H2,(H,18,19) |
| InChIKey | GWBSYTKBYVYNGG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |