C19H21N5O — CID 146642263
1-(1-phenylpiperidin-4-yl)-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)urea (PubChem CID 146642263) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(1-phenylpiperidin-4-yl)-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)urea.
| Compound Name | 1-(1-phenylpiperidin-4-yl)-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)urea |
|---|---|
| PubChem CID | 146642263 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-(1-phenylpiperidin-4-yl)-3-(1H-pyrrolo[3,2-b]pyridin-3-yl)urea |
| SMILES | O=C(Nc1c[nH]c2cccnc12)NC1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N5O/c25-19(23-17-13-21-16-7-4-10-20-18(16)17)22-14-8-11-24(12-9-14)15-5-2-1-3-6-15/h1-7,10,13-14,21H,8-9,11-12H2,(H2,22,23,25) |
| InChIKey | KVEMYNKWONUVDH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |