C14H19N7O — CID 167966617
1-(2-methyltetrazol-5-yl)-3-(1-phenylpiperidin-4-yl)urea (PubChem CID 167966617) has the molecular formula C14H19N7O and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(2-methyltetrazol-5-yl)-3-(1-phenylpiperidin-4-yl)urea.
| Compound Name | 1-(2-methyltetrazol-5-yl)-3-(1-phenylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 167966617 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-(2-methyltetrazol-5-yl)-3-(1-phenylpiperidin-4-yl)urea |
| SMILES | Cn1nnc(NC(=O)NC2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C14H19N7O/c1-20-18-13(17-19-20)16-14(22)15-11-7-9-21(10-8-11)12-5-3-2-4-6-12/h2-6,11H,7-10H2,1H3,(H2,15,16,18,22) |
| InChIKey | GNKWXIHKZWHQDB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |