C21H25N3O — CID 51050042
1-[(1S,2R)-2-phenylcyclopropyl]-3-(1-phenylpiperidin-4-yl)urea (PubChem CID 51050042) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[(1S,2R)-2-phenylcyclopropyl]-3-(1-phenylpiperidin-4-yl)urea.
| Compound Name | 1-[(1S,2R)-2-phenylcyclopropyl]-3-(1-phenylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 51050042 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-[(1S,2R)-2-phenylcyclopropyl]-3-(1-phenylpiperidin-4-yl)urea |
| SMILES | O=C(NC1CCN(c2ccccc2)CC1)N[C@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H25N3O/c25-21(23-20-15-19(20)16-7-3-1-4-8-16)22-17-11-13-24(14-12-17)18-9-5-2-6-10-18/h1-10,17,19-20H,11-15H2,(H2,22,23,25)/t19-,20+/m1/s1 |
| InChIKey | OKBCQVXLHZLMAA-UXHICEINSA-N |
| XLogP | 3.51 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |