C14H22N4O2 — CID 154772846
cyclohexylmethyl N-[2-(pyridazin-3-ylamino)ethyl]carbamate (PubChem CID 154772846) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is cyclohexylmethyl N-[2-(pyridazin-3-ylamino)ethyl]carbamate.
| Compound Name | cyclohexylmethyl N-[2-(pyridazin-3-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 154772846 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | cyclohexylmethyl N-[2-(pyridazin-3-ylamino)ethyl]carbamate |
| SMILES | O=C(NCCNc1cccnn1)OCC1CCCCC1 |
| InChI | InChI=1S/C14H22N4O2/c19-14(20-11-12-5-2-1-3-6-12)16-10-9-15-13-7-4-8-17-18-13/h4,7-8,12H,1-3,5-6,9-11H2,(H,15,18)(H,16,19) |
| InChIKey | SBAYIHOLPTVHAS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|