C17H25N3O2S — CID 163837568
cyclohexylmethyl N-[2-[[amino-(2-sulfanylphenyl)methylidene]amino]ethyl]carbamate (PubChem CID 163837568) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is cyclohexylmethyl N-[2-[[amino-(2-sulfanylphenyl)methylidene]amino]ethyl]carbamate.
| Compound Name | cyclohexylmethyl N-[2-[[amino-(2-sulfanylphenyl)methylidene]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 163837568 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | cyclohexylmethyl N-[2-[[amino-(2-sulfanylphenyl)methylidene]amino]ethyl]carbamate |
| SMILES | N/C(=N\CCNC(=O)OCC1CCCCC1)c1ccccc1S |
| InChI | InChI=1S/C17H25N3O2S/c18-16(14-8-4-5-9-15(14)23)19-10-11-20-17(21)22-12-13-6-2-1-3-7-13/h4-5,8-9,13,23H,1-3,6-7,10-12H2,(H2,18,19)(H,20,21) |
| InChIKey | OJDGKBQWWBXEOL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|