About 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone
2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone (PubChem CID 84672305) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone.
Molecular Properties
| Compound Name | 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone |
| PubChem CID | 84672305 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone |
| SMILES | Cc1nc2c(C(=O)CN)ccnc2n1C |
| InChI | InChI=1S/C10H12N4O/c1-6-13-9-7(8(15)5-11)3-4-12-10(9)14(6)2/h3-4H,5,11H2,1-2H3 |
| InChIKey | WCPQTBFTHQBTCV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone?
The IUPAC name of 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone (CID 84672305) is 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone.
What is the SMILES notation for 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone?
The canonical SMILES for 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone is Cc1nc2c(C(=O)CN)ccnc2n1C.
What is the InChIKey of 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone?
The InChIKey is WCPQTBFTHQBTCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-6-13-9-7(8(15)5-11)3-4-12-10(9)14(6)2/h3-4H,5,11H2,1-2H3.
What are the key properties of 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone?
2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone has a molecular weight of 204.23 g/mol, XLogP of 0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,3-dimethylimidazo[4,5-b]pyridin-7-yl)ethanone is sourced from PubChem (CID 84672305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).