C8H5ClN2OS — CID 144796857
2-chlorothieno[3,2-b]pyridine-3-carboxamide (PubChem CID 144796857) has the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. Its IUPAC name is 2-chlorothieno[3,2-b]pyridine-3-carboxamide.
| Compound Name | 2-chlorothieno[3,2-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144796857 |
| Molecular Formula | C8H5ClN2OS |
| Molecular Weight | 212.66 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 2-chlorothieno[3,2-b]pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(Cl)sc2cccnc12 |
| InChI | InChI=1S/C8H5ClN2OS/c9-7-5(8(10)12)6-4(13-7)2-1-3-11-6/h1-3H,(H2,10,12) |
| InChIKey | SSUDFYVQIIZVBA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.66 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |