C14H11BrN2 — CID 158249531
1-(3-bromophenyl)-4H-1,8-naphthyridine (PubChem CID 158249531) has the molecular formula C14H11BrN2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4H-1,8-naphthyridine.
| Compound Name | 1-(3-bromophenyl)-4H-1,8-naphthyridine |
|---|---|
| PubChem CID | 158249531 |
| Molecular Formula | C14H11BrN2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 1-(3-bromophenyl)-4H-1,8-naphthyridine |
| SMILES | Brc1cccc(N2C=CCc3cccnc32)c1 |
| InChI | InChI=1S/C14H11BrN2/c15-12-6-1-7-13(10-12)17-9-3-5-11-4-2-8-16-14(11)17/h1-4,6-10H,5H2 |
| InChIKey | GGNSKBQVJWNKOB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |