About 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine
2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine (PubChem CID 117224043) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine.
Analyze 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine?
The IUPAC name of 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine (CID 117224043) is 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine.
What is the SMILES notation for 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine?
The canonical SMILES for 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine is NCCN1CCc2ncccc21.
What is the InChIKey of 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine?
The InChIKey is JWIYZJMUMOWNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c10-4-7-12-6-3-8-9(12)2-1-5-11-8/h1-2,5H,3-4,6-7,10H2.
What are the key properties of 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine?
2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine has a molecular weight of 163.22 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydropyrrolo[3,2-b]pyridin-1-yl)ethanamine is sourced from PubChem (CID 117224043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).