C15H17N4 — CID 102140339
CID 102140339 (PubChem CID 102140339) has the molecular formula C15H17N4 and a molecular weight of 253.33 g/mol.
| Compound Name | CID 102140339 |
|---|---|
| PubChem CID | 102140339 |
| Molecular Formula | C15H17N4 |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | — |
| SMILES | NCCN1[CH]N(Cc2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C15H17N4/c16-8-10-18-12-19(11-13-5-3-4-9-17-13)15-7-2-1-6-14(15)18/h1-7,9,12H,8,10-11,16H2 |
| InChIKey | PSIPCBYFJCMDGX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |