About CID 102253209
CID 102253209 (PubChem CID 102253209) has the molecular formula C10H12N3
and a molecular weight of 174.23 g/mol.
Molecular Properties
| Compound Name | CID 102253209 |
| PubChem CID | 102253209 |
| Molecular Formula | C10H12N3 |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | — |
| SMILES | CN1[CH]N(Cc2ccccn2)C=C1 |
| InChI | InChI=1S/C10H12N3/c1-12-6-7-13(9-12)8-10-4-2-3-5-11-10/h2-7,9H,8H2,1H3 |
| InChIKey | RQYCOLQNRQWISS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 102253209 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102253209?
The IUPAC name of CID 102253209 (CID 102253209) is not available.
What is the SMILES notation for CID 102253209?
The canonical SMILES for CID 102253209 is CN1[CH]N(Cc2ccccn2)C=C1.
What is the InChIKey of CID 102253209?
The InChIKey is RQYCOLQNRQWISS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N3/c1-12-6-7-13(9-12)8-10-4-2-3-5-11-10/h2-7,9H,8H2,1H3.
What are the key properties of CID 102253209?
CID 102253209 has a molecular weight of 174.23 g/mol, XLogP of 1.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102253209 is sourced from PubChem (CID 102253209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).