C11H13N3 — CID 12988154
2-[(3,5-dimethylpyrazol-1-yl)methyl]pyridine (PubChem CID 12988154) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 2-[(3,5-dimethylpyrazol-1-yl)methyl]pyridine.
| Compound Name | 2-[(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 12988154 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 2-[(3,5-dimethylpyrazol-1-yl)methyl]pyridine |
| SMILES | Cc1cc(C)n(Cc2ccccn2)n1 |
| InChI | InChI=1S/C11H13N3/c1-9-7-10(2)14(13-9)8-11-5-3-4-6-12-11/h3-7H,8H2,1-2H3 |
| InChIKey | RVVDTAGINJPVFP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |