C22H29N5O2 — CID 15831001
1-[bis(pyridin-2-ylmethyl)amino]-3-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]propan-2-ol (PubChem CID 15831001) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-[bis(pyridin-2-ylmethyl)amino]-3-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]propan-2-ol.
| Compound Name | 1-[bis(pyridin-2-ylmethyl)amino]-3-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 15831001 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 1-[bis(pyridin-2-ylmethyl)amino]-3-[2-(3,5-dimethylpyrazol-1-yl)ethoxy]propan-2-ol |
| SMILES | Cc1cc(C)n(CCOCC(O)CN(Cc2ccccn2)Cc2ccccn2)n1 |
| InChI | InChI=1S/C22H29N5O2/c1-18-13-19(2)27(25-18)11-12-29-17-22(28)16-26(14-20-7-3-5-9-23-20)15-21-8-4-6-10-24-21/h3-10,13,22,28H,11-12,14-17H2,1-2H3 |
| InChIKey | WRDMOYMLHJEHCM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|